C23H29ClN4OS — CID 92662168
3-(4-chlorophenyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 92662168) has the molecular formula C23H29ClN4OS and a molecular weight of 445.03 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 92662168 |
| Molecular Formula | C23H29ClN4OS |
| Molecular Weight | 445.03 g/mol |
| Exact Mass | 444.18 |
| IUPAC Name | 3-(4-chlorophenyl)-N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)c2cc3c(-c4ccc(Cl)cc4)nn(C)c3s2)C1 |
| InChI | InChI=1S/C23H29ClN4OS/c1-15-11-16(2)14-28(13-15)10-4-9-25-22(29)20-12-19-21(26-27(3)23(19)30-20)17-5-7-18(24)8-6-17/h5-8,12,15-16H,4,9-11,13-14H2,1-3H3,(H,25,29)/t15-,16-/m1/s1 |
| InChIKey | WKSYPXGXVNLNKM-HZPDHXFCSA-N |
| XLogP | 5.05 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.03 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|