C23H30ClN5OS — CID 55657127
1-[(4-chlorophenyl)methyl]-3-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 55657127) has the molecular formula C23H30ClN5OS and a molecular weight of 460.05 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55657127 |
| Molecular Formula | C23H30ClN5OS |
| Molecular Weight | 460.05 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c2sc(C(=O)NCCCCN3CCN(C)CC3)cc12 |
| InChI | InChI=1S/C23H30ClN5OS/c1-17-20-15-21(22(30)25-9-3-4-10-28-13-11-27(2)12-14-28)31-23(20)29(26-17)16-18-5-7-19(24)8-6-18/h5-8,15H,3-4,9-14,16H2,1-2H3,(H,25,30) |
| InChIKey | UTXIJVUFJQUNBW-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.05 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|