C17H19ClN4OS — CID 119406494
N-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 119406494) has the molecular formula C17H19ClN4OS and a molecular weight of 362.89 g/mol. Its IUPAC name is N-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | N-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 119406494 |
| Molecular Formula | C17H19ClN4OS |
| Molecular Weight | 362.89 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | N-(3-aminopropyl)-1-[(4-chlorophenyl)methyl]-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccc(Cl)cc2)c2sc(C(=O)NCCCN)cc12 |
| InChI | InChI=1S/C17H19ClN4OS/c1-11-14-9-15(16(23)20-8-2-7-19)24-17(14)22(21-11)10-12-3-5-13(18)6-4-12/h3-6,9H,2,7-8,10,19H2,1H3,(H,20,23) |
| InChIKey | MHJGLNAMGRVOAJ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.89 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|