C19H22FN3O2S — CID 55724715
1-[(4-fluorophenyl)methyl]-N-(4-methoxybutyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 55724715) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-N-(4-methoxybutyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-N-(4-methoxybutyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 55724715 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-N-(4-methoxybutyl)-3-methylthieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | COCCCCNC(=O)c1cc2c(C)nn(Cc3ccc(F)cc3)c2s1 |
| InChI | InChI=1S/C19H22FN3O2S/c1-13-16-11-17(18(24)21-9-3-4-10-25-2)26-19(16)23(22-13)12-14-5-7-15(20)8-6-14/h5-8,11H,3-4,9-10,12H2,1-2H3,(H,21,24) |
| InChIKey | IACQIPCPMRUXBK-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|