C21H25FN4O2S — CID 17463930
1-[(4-fluorophenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrazole-5-carboxamide (PubChem CID 17463930) has the molecular formula C21H25FN4O2S and a molecular weight of 416.52 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrazole-5-carboxamide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 17463930 |
| Molecular Formula | C21H25FN4O2S |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-methyl-N-(3-morpholin-4-ylpropyl)thieno[3,2-d]pyrazole-5-carboxamide |
| SMILES | Cc1nn(Cc2ccc(F)cc2)c2sc(C(=O)NCCCN3CCOCC3)cc12 |
| InChI | InChI=1S/C21H25FN4O2S/c1-15-18-13-19(20(27)23-7-2-8-25-9-11-28-12-10-25)29-21(18)26(24-15)14-16-3-5-17(22)6-4-16/h3-6,13H,2,7-12,14H2,1H3,(H,23,27) |
| InChIKey | NUPOTQFZZVZBOF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|