C21H39N3O2 — CID 55980497
1-butanoyl-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]piperidine-4-carboxamide (PubChem CID 55980497) has the molecular formula C21H39N3O2 and a molecular weight of 365.56 g/mol. Its IUPAC name is 1-butanoyl-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]piperidine-4-carboxamide.
| Compound Name | 1-butanoyl-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55980497 |
| Molecular Formula | C21H39N3O2 |
| Molecular Weight | 365.56 g/mol |
| Exact Mass | 365.30 |
| IUPAC Name | 1-butanoyl-N-[4-(3,5-dimethylpiperidin-1-yl)butyl]piperidine-4-carboxamide |
| SMILES | CCCC(=O)N1CCC(C(=O)NCCCCN2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C21H39N3O2/c1-4-7-20(25)24-12-8-19(9-13-24)21(26)22-10-5-6-11-23-15-17(2)14-18(3)16-23/h17-19H,4-16H2,1-3H3,(H,22,26) |
| InChIKey | UQHQGNQMKUTJRK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.56 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|