C19H27N3O4S — CID 82017354
N-(2,2-dimethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 82017354) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 82017354 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | CCn1c(C(=O)N2CCC(C(=O)NCC(OC)OC)CC2)cc2sccc21 |
| InChI | InChI=1S/C19H27N3O4S/c1-4-22-14-7-10-27-16(14)11-15(22)19(24)21-8-5-13(6-9-21)18(23)20-12-17(25-2)26-3/h7,10-11,13,17H,4-6,8-9,12H2,1-3H3,(H,20,23) |
| InChIKey | DWUVHYUPJBTJMR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|