C21H31N3O4S — CID 82017353
N-(2,2-diethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide (PubChem CID 82017353) has the molecular formula C21H31N3O4S and a molecular weight of 421.56 g/mol. Its IUPAC name is N-(2,2-diethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-(2,2-diethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 82017353 |
| Molecular Formula | C21H31N3O4S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | N-(2,2-diethoxyethyl)-1-(4-ethylthieno[3,2-b]pyrrole-5-carbonyl)piperidine-4-carboxamide |
| SMILES | CCOC(CNC(=O)C1CCN(C(=O)c2cc3sccc3n2CC)CC1)OCC |
| InChI | InChI=1S/C21H31N3O4S/c1-4-24-16-9-12-29-18(16)13-17(24)21(26)23-10-7-15(8-11-23)20(25)22-14-19(27-5-2)28-6-3/h9,12-13,15,19H,4-8,10-11,14H2,1-3H3,(H,22,25) |
| InChIKey | BBNFMFAHZXHSAM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|