C20H33N3O3S2 — CID 28564477
N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide (PubChem CID 28564477) has the molecular formula C20H33N3O3S2 and a molecular weight of 427.64 g/mol. Its IUPAC name is N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide.
| Compound Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 28564477 |
| Molecular Formula | C20H33N3O3S2 |
| Molecular Weight | 427.64 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | N-[3-[(3R,5R)-3,5-dimethylpiperidin-1-yl]propyl]-1-thiophen-2-ylsulfonylpiperidine-4-carboxamide |
| SMILES | C[C@@H]1C[C@@H](C)CN(CCCNC(=O)C2CCN(S(=O)(=O)c3cccs3)CC2)C1 |
| InChI | InChI=1S/C20H33N3O3S2/c1-16-13-17(2)15-22(14-16)9-4-8-21-20(24)18-6-10-23(11-7-18)28(25,26)19-5-3-12-27-19/h3,5,12,16-18H,4,6-11,13-15H2,1-2H3,(H,21,24)/t16-,17-/m1/s1 |
| InChIKey | WUJGMCVCGYCATE-IAGOWNOFSA-N |
| XLogP | 2.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.64 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|