C25H37N3O4 — CID 91635069
5-[(3-methoxycyclohexanecarbonyl)amino]-N-(2-methoxyethyl)-1-(3-methylbutyl)indole-2-carboxamide (PubChem CID 91635069) has the molecular formula C25H37N3O4 and a molecular weight of 443.59 g/mol. Its IUPAC name is 5-[(3-methoxycyclohexanecarbonyl)amino]-N-(2-methoxyethyl)-1-(3-methylbutyl)indole-2-carboxamide.
| Compound Name | 5-[(3-methoxycyclohexanecarbonyl)amino]-N-(2-methoxyethyl)-1-(3-methylbutyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 91635069 |
| Molecular Formula | C25H37N3O4 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | 5-[(3-methoxycyclohexanecarbonyl)amino]-N-(2-methoxyethyl)-1-(3-methylbutyl)indole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2cc(NC(=O)C3CCCC(OC)C3)ccc2n1CCC(C)C |
| InChI | InChI=1S/C25H37N3O4/c1-17(2)10-12-28-22-9-8-20(27-24(29)18-6-5-7-21(15-18)32-4)14-19(22)16-23(28)25(30)26-11-13-31-3/h8-9,14,16-18,21H,5-7,10-13,15H2,1-4H3,(H,26,30)(H,27,29) |
| InChIKey | KNVINPWOSVVAAV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|