C25H25N3O4 — CID 83276291
5-(furan-2-carbonylamino)-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide (PubChem CID 83276291) has the molecular formula C25H25N3O4 and a molecular weight of 431.49 g/mol. Its IUPAC name is 5-(furan-2-carbonylamino)-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide.
| Compound Name | 5-(furan-2-carbonylamino)-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 83276291 |
| Molecular Formula | C25H25N3O4 |
| Molecular Weight | 431.49 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | 5-(furan-2-carbonylamino)-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2cc(NC(=O)c3ccco3)ccc2n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C25H25N3O4/c1-17-5-3-6-18(13-17)16-28-21-9-8-20(27-25(30)23-7-4-11-32-23)14-19(21)15-22(28)24(29)26-10-12-31-2/h3-9,11,13-15H,10,12,16H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | IIUQFCLSMYBPDT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 85.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|