C23H22N4O3 — CID 83273760
1-ethyl-5-(furan-2-carbonylamino)-N-(2-pyridin-2-ylethyl)indole-2-carboxamide (PubChem CID 83273760) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is 1-ethyl-5-(furan-2-carbonylamino)-N-(2-pyridin-2-ylethyl)indole-2-carboxamide.
| Compound Name | 1-ethyl-5-(furan-2-carbonylamino)-N-(2-pyridin-2-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 83273760 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | 1-ethyl-5-(furan-2-carbonylamino)-N-(2-pyridin-2-ylethyl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCCc2ccccn2)cc2cc(NC(=O)c3ccco3)ccc21 |
| InChI | InChI=1S/C23H22N4O3/c1-2-27-19-9-8-18(26-23(29)21-7-5-13-30-21)14-16(19)15-20(27)22(28)25-12-10-17-6-3-4-11-24-17/h3-9,11,13-15H,2,10,12H2,1H3,(H,25,28)(H,26,29) |
| InChIKey | CUKIGUHVGZNZAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 89.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |