C21H23N5O2 — CID 111191502
N-[4-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide (PubChem CID 111191502) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[4-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide.
| Compound Name | N-[4-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 111191502 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[4-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1ccc(NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C21H23N5O2/c1-22-21(24-13-11-17-5-2-3-12-23-17)25-15-16-7-9-18(10-8-16)26-20(27)19-6-4-14-28-19/h2-10,12,14H,11,13,15H2,1H3,(H,26,27)(H2,22,24,25) |
| InChIKey | LRTUPSYRZKMTET-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|