C18H23N5O — CID 111193650
N-methyl-3-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzamide (PubChem CID 111193650) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is N-methyl-3-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzamide.
| Compound Name | N-methyl-3-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 111193650 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-methyl-3-[[[N'-methyl-N-(2-pyridin-2-ylethyl)carbamimidoyl]amino]methyl]benzamide |
| SMILES | C/N=C(\NCCc1ccccn1)NCc1cccc(C(=O)NC)c1 |
| InChI | InChI=1S/C18H23N5O/c1-19-17(24)15-7-5-6-14(12-15)13-23-18(20-2)22-11-9-16-8-3-4-10-21-16/h3-8,10,12H,9,11,13H2,1-2H3,(H,19,24)(H2,20,22,23) |
| InChIKey | WGPYBBWPXBBWOP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|