C19H25N5O — CID 111668260
N,N-dimethyl-3-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide (PubChem CID 111668260) has the molecular formula C19H25N5O and a molecular weight of 339.44 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide.
| Compound Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 111668260 |
| Molecular Formula | C19H25N5O |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | N,N-dimethyl-3-[2-[[N'-methyl-N-(pyridin-2-ylmethyl)carbamimidoyl]amino]ethyl]benzamide |
| SMILES | C/N=C(/NCCc1cccc(C(=O)N(C)C)c1)NCc1ccccn1 |
| InChI | InChI=1S/C19H25N5O/c1-20-19(23-14-17-9-4-5-11-21-17)22-12-10-15-7-6-8-16(13-15)18(25)24(2)3/h4-9,11,13H,10,12,14H2,1-3H3,(H2,20,22,23) |
| InChIKey | GGGBEZGYKDJUIE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|