C23H27IN4O2 — CID 111342994
N-[4-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide (PubChem CID 111342994) has the molecular formula C23H27IN4O2 and a molecular weight of 518.40 g/mol. Its IUPAC name is N-[4-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide.
| Compound Name | N-[4-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111342994 |
| Molecular Formula | C23H27IN4O2 |
| Molecular Weight | 518.40 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | N-[4-[[[N'-methyl-N-(2-phenylpropyl)carbamimidoyl]amino]methyl]phenyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(NC(=O)c2ccco2)cc1)NCC(C)c1ccccc1.I |
| InChI | InChI=1S/C23H26N4O2.HI/c1-17(19-7-4-3-5-8-19)15-25-23(24-2)26-16-18-10-12-20(13-11-18)27-22(28)21-9-6-14-29-21;/h3-14,17H,15-16H2,1-2H3,(H,27,28)(H2,24,25,26);1H |
| InChIKey | BJOMUVWSFDVPKU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|