C28H28FN3O3 — CID 83287983
5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide (PubChem CID 83287983) has the molecular formula C28H28FN3O3 and a molecular weight of 473.55 g/mol. Its IUPAC name is 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide.
| Compound Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 83287983 |
| Molecular Formula | C28H28FN3O3 |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 5-[[2-(4-fluorophenyl)acetyl]amino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2cc(NC(=O)Cc3ccc(F)cc3)ccc2n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C28H28FN3O3/c1-19-4-3-5-21(14-19)18-32-25-11-10-24(31-27(33)15-20-6-8-23(29)9-7-20)16-22(25)17-26(32)28(34)30-12-13-35-2/h3-11,14,16-17H,12-13,15,18H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | VHZVINSLVQOMIY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|