C24H29N3O3 — CID 83281983
5-[(3,4-dimethylbenzoyl)amino]-N-(2-methoxyethyl)-1-propylindole-2-carboxamide (PubChem CID 83281983) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 5-[(3,4-dimethylbenzoyl)amino]-N-(2-methoxyethyl)-1-propylindole-2-carboxamide.
| Compound Name | 5-[(3,4-dimethylbenzoyl)amino]-N-(2-methoxyethyl)-1-propylindole-2-carboxamide |
|---|---|
| PubChem CID | 83281983 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 5-[(3,4-dimethylbenzoyl)amino]-N-(2-methoxyethyl)-1-propylindole-2-carboxamide |
| SMILES | CCCn1c(C(=O)NCCOC)cc2cc(NC(=O)c3ccc(C)c(C)c3)ccc21 |
| InChI | InChI=1S/C24H29N3O3/c1-5-11-27-21-9-8-20(26-23(28)18-7-6-16(2)17(3)13-18)14-19(21)15-22(27)24(29)25-10-12-30-4/h6-9,13-15H,5,10-12H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | STHCKXAVHAYQMD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|