C25H30N4O3 — CID 83288364
1-ethyl-5-[(4-methylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)indole-2-carboxamide (PubChem CID 83288364) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-ethyl-5-[(4-methylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)indole-2-carboxamide.
| Compound Name | 1-ethyl-5-[(4-methylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)indole-2-carboxamide |
|---|---|
| PubChem CID | 83288364 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 1-ethyl-5-[(4-methylbenzoyl)amino]-N-(2-morpholin-4-ylethyl)indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCCN2CCOCC2)cc2cc(NC(=O)c3ccc(C)cc3)ccc21 |
| InChI | InChI=1S/C25H30N4O3/c1-3-29-22-9-8-21(27-24(30)19-6-4-18(2)5-7-19)16-20(22)17-23(29)25(31)26-10-11-28-12-14-32-15-13-28/h4-9,16-17H,3,10-15H2,1-2H3,(H,26,31)(H,27,30) |
| InChIKey | JZGYFHJSZLZQKC-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |