C26H26ClN3O4S — CID 42808901
5-[(4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide (PubChem CID 42808901) has the molecular formula C26H26ClN3O4S and a molecular weight of 512.03 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 42808901 |
| Molecular Formula | C26H26ClN3O4S |
| Molecular Weight | 512.03 g/mol |
| Exact Mass | 511.13 |
| IUPAC Name | 5-[(4-chlorophenyl)sulfonylamino]-N-(2-methoxyethyl)-1-[(3-methylphenyl)methyl]indole-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2cc(NS(=O)(=O)c3ccc(Cl)cc3)ccc2n1Cc1cccc(C)c1 |
| InChI | InChI=1S/C26H26ClN3O4S/c1-18-4-3-5-19(14-18)17-30-24-11-8-22(29-35(32,33)23-9-6-21(27)7-10-23)15-20(24)16-25(30)26(31)28-12-13-34-2/h3-11,14-16,29H,12-13,17H2,1-2H3,(H,28,31) |
| InChIKey | NKZXUQAJVOZLHW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.03 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|