C17H23N3O4S — CID 50802007
5-(dimethylsulfamoyl)-N-(2-methoxyethyl)-1-prop-2-enylindole-2-carboxamide (PubChem CID 50802007) has the molecular formula C17H23N3O4S and a molecular weight of 365.46 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(2-methoxyethyl)-1-prop-2-enylindole-2-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(2-methoxyethyl)-1-prop-2-enylindole-2-carboxamide |
|---|---|
| PubChem CID | 50802007 |
| Molecular Formula | C17H23N3O4S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(2-methoxyethyl)-1-prop-2-enylindole-2-carboxamide |
| SMILES | C=CCn1c(C(=O)NCCOC)cc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C17H23N3O4S/c1-5-9-20-15-7-6-14(25(22,23)19(2)3)11-13(15)12-16(20)17(21)18-8-10-24-4/h5-7,11-12H,1,8-10H2,2-4H3,(H,18,21) |
| InChIKey | YNCVARHESZGCFP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|