C33H31N3O3 — CID 83287300
N-benzyl-1-[(3-methylphenyl)methyl]-5-[(2-phenylmethoxyacetyl)amino]indole-2-carboxamide (PubChem CID 83287300) has the molecular formula C33H31N3O3 and a molecular weight of 517.63 g/mol. Its IUPAC name is N-benzyl-1-[(3-methylphenyl)methyl]-5-[(2-phenylmethoxyacetyl)amino]indole-2-carboxamide.
| Compound Name | N-benzyl-1-[(3-methylphenyl)methyl]-5-[(2-phenylmethoxyacetyl)amino]indole-2-carboxamide |
|---|---|
| PubChem CID | 83287300 |
| Molecular Formula | C33H31N3O3 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | N-benzyl-1-[(3-methylphenyl)methyl]-5-[(2-phenylmethoxyacetyl)amino]indole-2-carboxamide |
| SMILES | Cc1cccc(Cn2c(C(=O)NCc3ccccc3)cc3cc(NC(=O)COCc4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C33H31N3O3/c1-24-9-8-14-27(17-24)21-36-30-16-15-29(35-32(37)23-39-22-26-12-6-3-7-13-26)18-28(30)19-31(36)33(38)34-20-25-10-4-2-5-11-25/h2-19H,20-23H2,1H3,(H,34,38)(H,35,37) |
| InChIKey | UULKZTAHQFICEQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |