C21H25N5O2 — CID 92612806
cis-(1R,3S)-N-[4-(2,3-dimethylimidazo[1,2-b][1,2,4]triazin-6-yl)phenyl]-3-methoxycyclohexane-1-carboxamide (PubChem CID 92612806) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is cis-(1R,3S)-N-[4-(2,3-dimethylimidazo[1,2-b][1,2,4]triazin-6-yl)phenyl]-3-methoxycyclohexane-1-carboxamide.
| Compound Name | cis-(1R,3S)-N-[4-(2,3-dimethylimidazo[1,2-b][1,2,4]triazin-6-yl)phenyl]-3-methoxycyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 92612806 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | cis-(1R,3S)-N-[4-(2,3-dimethylimidazo[1,2-b][1,2,4]triazin-6-yl)phenyl]-3-methoxycyclohexane-1-carboxamide |
| SMILES | CO[C@H]1CCC[C@@H](C(=O)Nc2ccc(-c3cn4nc(C)c(C)nc4n3)cc2)C1 |
| InChI | InChI=1S/C21H25N5O2/c1-13-14(2)25-26-12-19(24-21(26)22-13)15-7-9-17(10-8-15)23-20(27)16-5-4-6-18(11-16)28-3/h7-10,12,16,18H,4-6,11H2,1-3H3,(H,23,27)/t16-,18+/m1/s1 |
| InChIKey | XGTGZRXYKJLWDG-AEFFLSMTSA-N |
| XLogP | 3.55 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |