C18H29NO2 — CID 144736513
N-(4-methoxyphenyl)-3-methylcyclohexane-1-carboxamide;propane (PubChem CID 144736513) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-3-methylcyclohexane-1-carboxamide;propane.
| Compound Name | N-(4-methoxyphenyl)-3-methylcyclohexane-1-carboxamide;propane |
|---|---|
| PubChem CID | 144736513 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | N-(4-methoxyphenyl)-3-methylcyclohexane-1-carboxamide;propane |
| SMILES | CCC.COc1ccc(NC(=O)C2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C15H21NO2.C3H8/c1-11-4-3-5-12(10-11)15(17)16-13-6-8-14(18-2)9-7-13;1-3-2/h6-9,11-12H,3-5,10H2,1-2H3,(H,16,17);3H2,1-2H3 |
| InChIKey | MHZMTSPTNFYFJZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |