C15H18N2OS — CID 154972346
[4-[(3-methylcyclohexanecarbonyl)amino]phenyl] thiocyanate (PubChem CID 154972346) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is [4-[(3-methylcyclohexanecarbonyl)amino]phenyl] thiocyanate.
| Compound Name | [4-[(3-methylcyclohexanecarbonyl)amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 154972346 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | [4-[(3-methylcyclohexanecarbonyl)amino]phenyl] thiocyanate |
| SMILES | CC1CCCC(C(=O)Nc2ccc(SC#N)cc2)C1 |
| InChI | InChI=1S/C15H18N2OS/c1-11-3-2-4-12(9-11)15(18)17-13-5-7-14(8-6-13)19-10-16/h5-8,11-12H,2-4,9H2,1H3,(H,17,18) |
| InChIKey | UYYNWXMZYQEFBF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|