C22H22N4O2S — CID 108791145
[4-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]phenyl] thiocyanate (PubChem CID 108791145) has the molecular formula C22H22N4O2S and a molecular weight of 406.51 g/mol. Its IUPAC name is [4-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108791145 |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [4-[[5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carbonyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C2CC(=O)N(c3ccc(N4CCCC4)cc3)C2)cc1 |
| InChI | InChI=1S/C22H22N4O2S/c23-15-29-20-9-3-17(4-10-20)24-22(28)16-13-21(27)26(14-16)19-7-5-18(6-8-19)25-11-1-2-12-25/h3-10,16H,1-2,11-14H2,(H,24,28) |
| InChIKey | UBYCSDLERDOBDL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|