C22H25N3O2 — CID 46422723
5-oxo-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 46422723) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 5-oxo-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 46422723 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 5-oxo-1-phenyl-N-(4-piperidin-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(N2CCCCC2)cc1)C1CC(=O)N(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25N3O2/c26-21-15-17(16-25(21)20-7-3-1-4-8-20)22(27)23-18-9-11-19(12-10-18)24-13-5-2-6-14-24/h1,3-4,7-12,17H,2,5-6,13-16H2,(H,23,27) |
| InChIKey | LGWXSHAYQUWHBF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|