C19H15N3O4S — CID 108791305
[4-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl] thiocyanate (PubChem CID 108791305) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is [4-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl] thiocyanate.
| Compound Name | [4-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl] thiocyanate |
|---|---|
| PubChem CID | 108791305 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | [4-[[1-(1,3-benzodioxol-5-yl)-5-oxopyrrolidine-3-carbonyl]amino]phenyl] thiocyanate |
| SMILES | N#CSc1ccc(NC(=O)C2CC(=O)N(c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C19H15N3O4S/c20-10-27-15-4-1-13(2-5-15)21-19(24)12-7-18(23)22(9-12)14-3-6-16-17(8-14)26-11-25-16/h1-6,8,12H,7,9,11H2,(H,21,24) |
| InChIKey | WUJXGMGOGJEFQL-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|