C17H26ClNO — CID 142985904
N-(4-chlorophenyl)-3-methylcyclohexane-1-carboxamide;propane (PubChem CID 142985904) has the molecular formula C17H26ClNO and a molecular weight of 295.85 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-methylcyclohexane-1-carboxamide;propane.
| Compound Name | N-(4-chlorophenyl)-3-methylcyclohexane-1-carboxamide;propane |
|---|---|
| PubChem CID | 142985904 |
| Molecular Formula | C17H26ClNO |
| Molecular Weight | 295.85 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(4-chlorophenyl)-3-methylcyclohexane-1-carboxamide;propane |
| SMILES | CC1CCCC(C(=O)Nc2ccc(Cl)cc2)C1.CCC |
| InChI | InChI=1S/C14H18ClNO.C3H8/c1-10-3-2-4-11(9-10)14(17)16-13-7-5-12(15)6-8-13;1-3-2/h5-8,10-11H,2-4,9H2,1H3,(H,16,17);3H2,1-2H3 |
| InChIKey | XUNZXIUHVCKLHG-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.85 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |