C16H23ClN2O — CID 176941389
N-(4-chlorophenyl)-6-azabicyclo[3.1.1]heptane-6-carboxamide;propane (PubChem CID 176941389) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is N-(4-chlorophenyl)-6-azabicyclo[3.1.1]heptane-6-carboxamide;propane.
| Compound Name | N-(4-chlorophenyl)-6-azabicyclo[3.1.1]heptane-6-carboxamide;propane |
|---|---|
| PubChem CID | 176941389 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | N-(4-chlorophenyl)-6-azabicyclo[3.1.1]heptane-6-carboxamide;propane |
| SMILES | CCC.O=C(Nc1ccc(Cl)cc1)N1C2CCCC1C2 |
| InChI | InChI=1S/C13H15ClN2O.C3H8/c14-9-4-6-10(7-5-9)15-13(17)16-11-2-1-3-12(16)8-11;1-3-2/h4-7,11-12H,1-3,8H2,(H,15,17);3H2,1-2H3 |
| InChIKey | JNTWRRLAXMHRQE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |