C17H21ClN2O — CID 102434601
N-(4-chlorophenyl)-2,5-bis(prop-2-enyl)pyrrolidine-1-carboxamide (PubChem CID 102434601) has the molecular formula C17H21ClN2O and a molecular weight of 304.82 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2,5-bis(prop-2-enyl)pyrrolidine-1-carboxamide.
| Compound Name | N-(4-chlorophenyl)-2,5-bis(prop-2-enyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 102434601 |
| Molecular Formula | C17H21ClN2O |
| Molecular Weight | 304.82 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | N-(4-chlorophenyl)-2,5-bis(prop-2-enyl)pyrrolidine-1-carboxamide |
| SMILES | C=CCC1CCC(CC=C)N1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2O/c1-3-5-15-11-12-16(6-4-2)20(15)17(21)19-14-9-7-13(18)8-10-14/h3-4,7-10,15-16H,1-2,5-6,11-12H2,(H,19,21) |
| InChIKey | GHVGDFHVJNYQPK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|