C18H18Cl2N2O2 — CID 110190058
N,2-bis(4-chlorophenyl)-4-ethyl-1,3-oxazolidine-3-carboxamide (PubChem CID 110190058) has the molecular formula C18H18Cl2N2O2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N,2-bis(4-chlorophenyl)-4-ethyl-1,3-oxazolidine-3-carboxamide.
| Compound Name | N,2-bis(4-chlorophenyl)-4-ethyl-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 110190058 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | N,2-bis(4-chlorophenyl)-4-ethyl-1,3-oxazolidine-3-carboxamide |
| SMILES | CCC1COC(c2ccc(Cl)cc2)N1C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-2-16-11-24-17(12-3-5-13(19)6-4-12)22(16)18(23)21-15-9-7-14(20)8-10-15/h3-10,16-17H,2,11H2,1H3,(H,21,23) |
| InChIKey | ZFFZBETWAWESRH-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |