C29H29N3O2 — CID 83272478
1-[(4-tert-butylphenyl)methyl]-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide (PubChem CID 83272478) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is 1-[(4-tert-butylphenyl)methyl]-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide.
| Compound Name | 1-[(4-tert-butylphenyl)methyl]-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide |
|---|---|
| PubChem CID | 83272478 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[(4-tert-butylphenyl)methyl]-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(Cn2c(C(N)=O)cc3cc(NC(=O)/C=C/c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-29(2,3)23-12-9-21(10-13-23)19-32-25-15-14-24(17-22(25)18-26(32)28(30)34)31-27(33)16-11-20-7-5-4-6-8-20/h4-18H,19H2,1-3H3,(H2,30,34)(H,31,33)/b16-11+ |
| InChIKey | DMAIJNDCUHZHBL-LFIBNONCSA-N |
| XLogP | 5.74 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|