C31H24FN3O2 — CID 42808887
1-[(2-fluorophenyl)methyl]-N-phenyl-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide (PubChem CID 42808887) has the molecular formula C31H24FN3O2 and a molecular weight of 489.55 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-N-phenyl-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide.
| Compound Name | 1-[(2-fluorophenyl)methyl]-N-phenyl-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide |
|---|---|
| PubChem CID | 42808887 |
| Molecular Formula | C31H24FN3O2 |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-N-phenyl-5-[[(E)-3-phenylprop-2-enoyl]amino]indole-2-carboxamide |
| SMILES | O=C(/C=C/c1ccccc1)Nc1ccc2c(c1)cc(C(=O)Nc1ccccc1)n2Cc1ccccc1F |
| InChI | InChI=1S/C31H24FN3O2/c32-27-14-8-7-11-23(27)21-35-28-17-16-26(33-30(36)18-15-22-9-3-1-4-10-22)19-24(28)20-29(35)31(37)34-25-12-5-2-6-13-25/h1-20H,21H2,(H,33,36)(H,34,37)/b18-15+ |
| InChIKey | OYUBJCGOYGYCHD-OBGWFSINSA-N |
| XLogP | 6.73 |
| TPSA | 63.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|