C21H18FN3O3S — CID 171778479
(E)-N-[4-[(2-fluorophenyl)methylsulfamoyl]phenyl]-3-pyridin-4-ylprop-2-enamide (PubChem CID 171778479) has the molecular formula C21H18FN3O3S and a molecular weight of 411.46 g/mol. Its IUPAC name is (E)-N-[4-[(2-fluorophenyl)methylsulfamoyl]phenyl]-3-pyridin-4-ylprop-2-enamide.
| Compound Name | (E)-N-[4-[(2-fluorophenyl)methylsulfamoyl]phenyl]-3-pyridin-4-ylprop-2-enamide |
|---|---|
| PubChem CID | 171778479 |
| Molecular Formula | C21H18FN3O3S |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (E)-N-[4-[(2-fluorophenyl)methylsulfamoyl]phenyl]-3-pyridin-4-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccncc1)Nc1ccc(S(=O)(=O)NCc2ccccc2F)cc1 |
| InChI | InChI=1S/C21H18FN3O3S/c22-20-4-2-1-3-17(20)15-24-29(27,28)19-8-6-18(7-9-19)25-21(26)10-5-16-11-13-23-14-12-16/h1-14,24H,15H2,(H,25,26)/b10-5+ |
| InChIKey | LOJGSYISDKPKAA-BJMVGYQFSA-N |
| XLogP | 3.35 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|