C22H18F3N3O3S — CID 171778581
(E)-3-pyridin-4-yl-N-[4-[[3-(trifluoromethyl)phenyl]methylsulfamoyl]phenyl]prop-2-enamide (PubChem CID 171778581) has the molecular formula C22H18F3N3O3S and a molecular weight of 461.47 g/mol. Its IUPAC name is (E)-3-pyridin-4-yl-N-[4-[[3-(trifluoromethyl)phenyl]methylsulfamoyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-pyridin-4-yl-N-[4-[[3-(trifluoromethyl)phenyl]methylsulfamoyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 171778581 |
| Molecular Formula | C22H18F3N3O3S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | (E)-3-pyridin-4-yl-N-[4-[[3-(trifluoromethyl)phenyl]methylsulfamoyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccncc1)Nc1ccc(S(=O)(=O)NCc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C22H18F3N3O3S/c23-22(24,25)18-3-1-2-17(14-18)15-27-32(30,31)20-7-5-19(6-8-20)28-21(29)9-4-16-10-12-26-13-11-16/h1-14,27H,15H2,(H,28,29)/b9-4+ |
| InChIKey | UHOMBHPOCWPZGV-RUDMXATFSA-N |
| XLogP | 4.23 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|