C29H29F3N4O2 — CID 23573441
N-(4-aminophenyl)-5-(3,3-dimethylbutanoylamino)-1-[[2-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide (PubChem CID 23573441) has the molecular formula C29H29F3N4O2 and a molecular weight of 522.57 g/mol. Its IUPAC name is N-(4-aminophenyl)-5-(3,3-dimethylbutanoylamino)-1-[[2-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide.
| Compound Name | N-(4-aminophenyl)-5-(3,3-dimethylbutanoylamino)-1-[[2-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 23573441 |
| Molecular Formula | C29H29F3N4O2 |
| Molecular Weight | 522.57 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | N-(4-aminophenyl)-5-(3,3-dimethylbutanoylamino)-1-[[2-(trifluoromethyl)phenyl]methyl]indole-2-carboxamide |
| SMILES | CC(C)(C)CC(=O)Nc1ccc2c(c1)cc(C(=O)Nc1ccc(N)cc1)n2Cc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C29H29F3N4O2/c1-28(2,3)16-26(37)34-22-12-13-24-19(14-22)15-25(27(38)35-21-10-8-20(33)9-11-21)36(24)17-18-6-4-5-7-23(18)29(30,31)32/h4-15H,16-17,33H2,1-3H3,(H,34,37)(H,35,38) |
| InChIKey | ISNLQYUYDLNWRY-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.57 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|