C35H48FN3O4 — CID 142226351
ethane;ethyl 3-[[5-(3,3-dimethylbutanoylamino)-1-propylindole-2-carbonyl]amino]benzoate;(2Z,4Z)-1-fluorohexa-2,4-diene (PubChem CID 142226351) has the molecular formula C35H48FN3O4 and a molecular weight of 593.78 g/mol. Its IUPAC name is ethane;ethyl 3-[[5-(3,3-dimethylbutanoylamino)-1-propylindole-2-carbonyl]amino]benzoate;(2Z,4Z)-1-fluorohexa-2,4-diene.
| Compound Name | ethane;ethyl 3-[[5-(3,3-dimethylbutanoylamino)-1-propylindole-2-carbonyl]amino]benzoate;(2Z,4Z)-1-fluorohexa-2,4-diene |
|---|---|
| PubChem CID | 142226351 |
| Molecular Formula | C35H48FN3O4 |
| Molecular Weight | 593.78 g/mol |
| Exact Mass | 593.36 |
| IUPAC Name | ethane;ethyl 3-[[5-(3,3-dimethylbutanoylamino)-1-propylindole-2-carbonyl]amino]benzoate;(2Z,4Z)-1-fluorohexa-2,4-diene |
| SMILES | C/C=C\C=C/CF.CC.CCCn1c(C(=O)Nc2cccc(C(=O)OCC)c2)cc2cc(NC(=O)CC(C)(C)C)ccc21 |
| InChI | InChI=1S/C27H33N3O4.C6H9F.C2H6/c1-6-13-30-22-12-11-21(28-24(31)17-27(3,4)5)15-19(22)16-23(30)25(32)29-20-10-8-9-18(14-20)26(33)34-7-2;1-2-3-4-5-6-7;1-2/h8-12,14-16H,6-7,13,17H2,1-5H3,(H,28,31)(H,29,32);2-5H,6H2,1H3;1-2H3/b;3-2-,5-4-; |
| InChIKey | PEUABANRQLYBTB-AFHJKWRUSA-N |
| XLogP | 8.97 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.78 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|