C19H21F2N5O2 — CID 123435976
N-[N-(2,3-dihydro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 123435976) has the molecular formula C19H21F2N5O2 and a molecular weight of 389.41 g/mol. Its IUPAC name is N-[N-(2,3-dihydro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N-(2,3-dihydro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 123435976 |
| Molecular Formula | C19H21F2N5O2 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | N-[N-(2,3-dihydro-1H-indazol-3-yl)-N'-(2-ethoxyethyl)carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCOCC/N=C(\NC(=O)c1ccc(F)c(F)c1)NC1NNc2ccccc21 |
| InChI | InChI=1S/C19H21F2N5O2/c1-2-28-10-9-22-19(23-17-13-5-3-4-6-16(13)25-26-17)24-18(27)12-7-8-14(20)15(21)11-12/h3-8,11,17,25-26H,2,9-10H2,1H3,(H2,22,23,24,27) |
| InChIKey | VRXXYTWFIGPPTA-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|