C21H20F5N5O2 — CID 163865027
N-[N'-(3-ethoxypropyl)-N-[6-(trifluoromethyl)-2,5-dihydroindazol-3-ylidene]carbamimidoyl]-3,4-difluorobenzamide (PubChem CID 163865027) has the molecular formula C21H20F5N5O2 and a molecular weight of 469.41 g/mol. Its IUPAC name is N-[N'-(3-ethoxypropyl)-N-[6-(trifluoromethyl)-2,5-dihydroindazol-3-ylidene]carbamimidoyl]-3,4-difluorobenzamide.
| Compound Name | N-[N'-(3-ethoxypropyl)-N-[6-(trifluoromethyl)-2,5-dihydroindazol-3-ylidene]carbamimidoyl]-3,4-difluorobenzamide |
|---|---|
| PubChem CID | 163865027 |
| Molecular Formula | C21H20F5N5O2 |
| Molecular Weight | 469.41 g/mol |
| Exact Mass | 469.15 |
| IUPAC Name | N-[N'-(3-ethoxypropyl)-N-[6-(trifluoromethyl)-2,5-dihydroindazol-3-ylidene]carbamimidoyl]-3,4-difluorobenzamide |
| SMILES | CCOCCC/N=C(/N=C1NN=C2C=C(C(F)(F)F)CC=C21)NC(=O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H20F5N5O2/c1-2-33-9-3-8-27-20(29-19(32)12-4-7-15(22)16(23)10-12)28-18-14-6-5-13(21(24,25)26)11-17(14)30-31-18/h4,6-7,10-11H,2-3,5,8-9H2,1H3,(H2,27,28,29,31,32) |
| InChIKey | PFXJUYSYARJWFQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|