C15H20Cl2N2O3 — CID 7237354
2-ethoxyethyl N-(3,4-dichlorobenzoyl)-N'-propylcarbamimidate (PubChem CID 7237354) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 2-ethoxyethyl N-(3,4-dichlorobenzoyl)-N'-propylcarbamimidate.
| Compound Name | 2-ethoxyethyl N-(3,4-dichlorobenzoyl)-N'-propylcarbamimidate |
|---|---|
| PubChem CID | 7237354 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 2-ethoxyethyl N-(3,4-dichlorobenzoyl)-N'-propylcarbamimidate |
| SMILES | CCC/N=C(/NC(=O)c1ccc(Cl)c(Cl)c1)OCCOCC |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-3-7-18-15(22-9-8-21-4-2)19-14(20)11-5-6-12(16)13(17)10-11/h5-6,10H,3-4,7-9H2,1-2H3,(H,18,19,20) |
| InChIKey | KWZADZLOICSIBT-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|