C15H11BrClF2NO — CID 107999356
3-bromo-4-chloro-N-[1-(2,4-difluorophenyl)ethyl]benzamide (PubChem CID 107999356) has the molecular formula C15H11BrClF2NO and a molecular weight of 374.61 g/mol. Its IUPAC name is 3-bromo-4-chloro-N-[1-(2,4-difluorophenyl)ethyl]benzamide.
| Compound Name | 3-bromo-4-chloro-N-[1-(2,4-difluorophenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 107999356 |
| Molecular Formula | C15H11BrClF2NO |
| Molecular Weight | 374.61 g/mol |
| Exact Mass | 372.97 |
| IUPAC Name | 3-bromo-4-chloro-N-[1-(2,4-difluorophenyl)ethyl]benzamide |
| SMILES | CC(NC(=O)c1ccc(Cl)c(Br)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C15H11BrClF2NO/c1-8(11-4-3-10(18)7-14(11)19)20-15(21)9-2-5-13(17)12(16)6-9/h2-8H,1H3,(H,20,21) |
| InChIKey | XZFSTNCZTVYCPF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.61 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |