C12H17ClFNO2 — CID 97158414
(2R)-2-(4-chloro-3-fluorophenyl)-2-[[(2S)-1-methoxypropan-2-yl]amino]ethanol (PubChem CID 97158414) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is (2R)-2-(4-chloro-3-fluorophenyl)-2-[[(2S)-1-methoxypropan-2-yl]amino]ethanol.
| Compound Name | (2R)-2-(4-chloro-3-fluorophenyl)-2-[[(2S)-1-methoxypropan-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 97158414 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | (2R)-2-(4-chloro-3-fluorophenyl)-2-[[(2S)-1-methoxypropan-2-yl]amino]ethanol |
| SMILES | COC[C@H](C)N[C@@H](CO)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C12H17ClFNO2/c1-8(7-17-2)15-12(6-16)9-3-4-10(13)11(14)5-9/h3-5,8,12,15-16H,6-7H2,1-2H3/t8-,12-/m0/s1 |
| InChIKey | ORACAUYFUIZNBX-UFBFGSQYSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |