C16H23ClFNO3 — CID 110013383
tert-butyl 3-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]butanoate (PubChem CID 110013383) has the molecular formula C16H23ClFNO3 and a molecular weight of 331.82 g/mol. Its IUPAC name is tert-butyl 3-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]butanoate.
| Compound Name | tert-butyl 3-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]butanoate |
|---|---|
| PubChem CID | 110013383 |
| Molecular Formula | C16H23ClFNO3 |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | tert-butyl 3-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]butanoate |
| SMILES | CC(CC(=O)OC(C)(C)C)NC(CO)c1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H23ClFNO3/c1-10(7-15(21)22-16(2,3)4)19-14(9-20)11-5-6-12(17)13(18)8-11/h5-6,8,10,14,19-20H,7,9H2,1-4H3 |
| InChIKey | WCCFRIUEAOHBAF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |