C17H15ClFNO3 — CID 99699618
4-acetyl-N-[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzamide (PubChem CID 99699618) has the molecular formula C17H15ClFNO3 and a molecular weight of 335.76 g/mol. Its IUPAC name is 4-acetyl-N-[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzamide.
| Compound Name | 4-acetyl-N-[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzamide |
|---|---|
| PubChem CID | 99699618 |
| Molecular Formula | C17H15ClFNO3 |
| Molecular Weight | 335.76 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 4-acetyl-N-[(1S)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]benzamide |
| SMILES | CC(=O)c1ccc(C(=O)N[C@H](CO)c2ccc(Cl)c(F)c2)cc1 |
| InChI | InChI=1S/C17H15ClFNO3/c1-10(22)11-2-4-12(5-3-11)17(23)20-16(9-21)13-6-7-14(18)15(19)8-13/h2-8,16,21H,9H2,1H3,(H,20,23)/t16-/m1/s1 |
| InChIKey | CCPTZQNMAAXDKB-MRXNPFEDSA-N |
| XLogP | 3.15 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.76 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |