C12H17ClFNO2 — CID 142863332
N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]acetamide;ethane (PubChem CID 142863332) has the molecular formula C12H17ClFNO2 and a molecular weight of 261.72 g/mol. Its IUPAC name is N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]acetamide;ethane.
| Compound Name | N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]acetamide;ethane |
|---|---|
| PubChem CID | 142863332 |
| Molecular Formula | C12H17ClFNO2 |
| Molecular Weight | 261.72 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]acetamide;ethane |
| SMILES | CC.CC(=O)NC(CO)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClFNO2.C2H6/c1-6(15)13-10(5-14)7-2-3-9(12)8(11)4-7;1-2/h2-4,10,14H,5H2,1H3,(H,13,15);1-2H3 |
| InChIKey | CDCWDAODTGBFGY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |