C15H18ClFN4O2 — CID 166343817
4-amino-N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]-2-(1H-pyrazol-4-yl)butanamide (PubChem CID 166343817) has the molecular formula C15H18ClFN4O2 and a molecular weight of 340.79 g/mol. Its IUPAC name is 4-amino-N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]-2-(1H-pyrazol-4-yl)butanamide.
| Compound Name | 4-amino-N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]-2-(1H-pyrazol-4-yl)butanamide |
|---|---|
| PubChem CID | 166343817 |
| Molecular Formula | C15H18ClFN4O2 |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 4-amino-N-[1-(3-chloro-4-fluorophenyl)-2-hydroxyethyl]-2-(1H-pyrazol-4-yl)butanamide |
| SMILES | NCCC(C(=O)NC(CO)c1ccc(F)c(Cl)c1)c1cn[nH]c1 |
| InChI | InChI=1S/C15H18ClFN4O2/c16-12-5-9(1-2-13(12)17)14(8-22)21-15(23)11(3-4-18)10-6-19-20-7-10/h1-2,5-7,11,14,22H,3-4,8,18H2,(H,19,20)(H,21,23) |
| InChIKey | MNNIQEDLNDNMJY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 104.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |