C21H18B3Cl2FN4O6 — CID 169205976
CID 169205976 (PubChem CID 169205976) has the molecular formula C21H18B3Cl2FN4O6 and a molecular weight of 544.74 g/mol.
| Compound Name | CID 169205976 |
|---|---|
| PubChem CID | 169205976 |
| Molecular Formula | C21H18B3Cl2FN4O6 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.09 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C(O)(Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3ccc(F)c(Cl)c3)c2)c(Cl)cn1)C([B])(O)O |
| InChI | InChI=1S/C21H18B3Cl2FN4O6/c22-20(23,35)19(34,21(24,36)37)31-17-5-11(13(26)7-29-17)10-4-15(28-6-10)18(33)30-16(8-32)9-1-2-14(27)12(25)3-9/h1-7,16,28,32,34-37H,8H2,(H,29,31)(H,30,33)/t16-,19?/m1/s1 |
| InChIKey | FCZOTAFGSHGFBE-VTBWFHPJSA-N |
| XLogP | -0.12 |
| TPSA | 170.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|