C21H22B2Cl2N4O7 — CID 169205988
CID 169205988 (PubChem CID 169205988) has the molecular formula C21H22B2Cl2N4O7 and a molecular weight of 534.96 g/mol.
| Compound Name | CID 169205988 |
|---|---|
| PubChem CID | 169205988 |
| Molecular Formula | C21H22B2Cl2N4O7 |
| Molecular Weight | 534.96 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | — |
| SMILES | Clc1ccccc1.[B]C(O)(O)C(O)(Nc1cc(-c2c[nH]c(C(=O)NCCO)c2)c(Cl)cn1)C([B])(O)O |
| InChI | InChI=1S/C15H17B2ClN4O7.C6H5Cl/c16-14(26,27)13(25,15(17,28)29)22-11-4-8(9(18)6-21-11)7-3-10(20-5-7)12(24)19-1-2-23;7-6-4-2-1-3-5-6/h3-6,20,23,25-29H,1-2H2,(H,19,24)(H,21,22);1-5H |
| InChIKey | QATCJDIKACINGF-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.96 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|