C21H19B2Cl2FN4O7 — CID 169205888
CID 169205888 (PubChem CID 169205888) has the molecular formula C21H19B2Cl2FN4O7 and a molecular weight of 550.93 g/mol.
| Compound Name | CID 169205888 |
|---|---|
| PubChem CID | 169205888 |
| Molecular Formula | C21H19B2Cl2FN4O7 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.08 |
| IUPAC Name | — |
| SMILES | [B]C([B])(O)C(O)(Nc1cc(-c2c[nH]c(C(=O)N[C@H](CO)c3ccc(F)c(Cl)c3)c2)c(Cl)cn1)C(O)(O)O |
| InChI | InChI=1S/C21H19B2Cl2FN4O7/c22-20(23,34)19(33,21(35,36)37)30-17-5-11(13(25)7-28-17)10-4-15(27-6-10)18(32)29-16(8-31)9-1-2-14(26)12(24)3-9/h1-7,16,27,31,33-37H,8H2,(H,28,30)(H,29,32)/t16-,19?/m1/s1 |
| InChIKey | MFEZKQFPIQEAEZ-VTBWFHPJSA-N |
| XLogP | -0.30 |
| TPSA | 191.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|